C23H28ClN3O4 — CID 26002524
(2S)-2-(4-chlorophenyl)-2-[4-[4-(4-methoxyphenoxy)butanoyl]piperazin-1-yl]acetamide (PubChem CID 26002524) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-2-[4-[4-(4-methoxyphenoxy)butanoyl]piperazin-1-yl]acetamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-2-[4-[4-(4-methoxyphenoxy)butanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 26002524 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-2-[4-[4-(4-methoxyphenoxy)butanoyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc(OCCCC(=O)N2CCN([C@H](C(N)=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-30-19-8-10-20(11-9-19)31-16-2-3-21(28)26-12-14-27(15-13-26)22(23(25)29)17-4-6-18(24)7-5-17/h4-11,22H,2-3,12-16H2,1H3,(H2,25,29)/t22-/m0/s1 |
| InChIKey | YDCLIRZSPVTYQO-QFIPXVFZSA-N |
| XLogP | 2.88 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|