C23H27ClN2O4 — CID 108546992
1-[4-[2-(4-chlorophenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one (PubChem CID 108546992) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 1-[4-[2-(4-chlorophenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-[2-(4-chlorophenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108546992 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 1-[4-[2-(4-chlorophenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCCN(C(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN2O4/c24-19-9-11-21(12-10-19)30-18-23(28)26-14-5-13-25(15-16-26)22(27)8-4-17-29-20-6-2-1-3-7-20/h1-3,6-7,9-12H,4-5,8,13-18H2 |
| InChIKey | OFEPHAFPAJHFQR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|