C24H30N2O5 — CID 108536249
1-[4-[2-(4-ethoxyphenoxy)acetyl]piperazin-1-yl]-4-phenoxybutan-1-one (PubChem CID 108536249) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[4-[2-(4-ethoxyphenoxy)acetyl]piperazin-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-[2-(4-ethoxyphenoxy)acetyl]piperazin-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108536249 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[4-[2-(4-ethoxyphenoxy)acetyl]piperazin-1-yl]-4-phenoxybutan-1-one |
| SMILES | CCOc1ccc(OCC(=O)N2CCN(C(=O)CCCOc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O5/c1-2-29-21-10-12-22(13-11-21)31-19-24(28)26-16-14-25(15-17-26)23(27)9-6-18-30-20-7-4-3-5-8-20/h3-5,7-8,10-13H,2,6,9,14-19H2,1H3 |
| InChIKey | YOIAWALJOMURRR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|