C25H32N2O4 — CID 108535966
4-phenoxy-1-[4-[2-(2,3,6-trimethylphenoxy)acetyl]piperazin-1-yl]butan-1-one (PubChem CID 108535966) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-phenoxy-1-[4-[2-(2,3,6-trimethylphenoxy)acetyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-phenoxy-1-[4-[2-(2,3,6-trimethylphenoxy)acetyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108535966 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 4-phenoxy-1-[4-[2-(2,3,6-trimethylphenoxy)acetyl]piperazin-1-yl]butan-1-one |
| SMILES | Cc1ccc(C)c(OCC(=O)N2CCN(C(=O)CCCOc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C25H32N2O4/c1-19-11-12-20(2)25(21(19)3)31-18-24(29)27-15-13-26(14-16-27)23(28)10-7-17-30-22-8-5-4-6-9-22/h4-6,8-9,11-12H,7,10,13-18H2,1-3H3 |
| InChIKey | QRVFHOOJQIOXTL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|