C25H32N2O4 — CID 108546612
1-[4-[2-(3,4-dimethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one (PubChem CID 108546612) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one.
| Compound Name | 1-[4-[2-(3,4-dimethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
|---|---|
| PubChem CID | 108546612 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[4-[2-(3,4-dimethylphenoxy)acetyl]-1,4-diazepan-1-yl]-4-phenoxybutan-1-one |
| SMILES | Cc1ccc(OCC(=O)N2CCCN(C(=O)CCCOc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C25H32N2O4/c1-20-11-12-23(18-21(20)2)31-19-25(29)27-14-7-13-26(15-16-27)24(28)10-6-17-30-22-8-4-3-5-9-22/h3-5,8-9,11-12,18H,6-7,10,13-17,19H2,1-2H3 |
| InChIKey | DNIZQKXQQBKIGA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|