C18H25ClN2O3 — CID 94485126
1-(4-acetyl-1,4-diazepan-1-yl)-4-(4-chloro-3-methylphenoxy)butan-1-one (PubChem CID 94485126) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazepan-1-yl)-4-(4-chloro-3-methylphenoxy)butan-1-one.
| Compound Name | 1-(4-acetyl-1,4-diazepan-1-yl)-4-(4-chloro-3-methylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 94485126 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(4-acetyl-1,4-diazepan-1-yl)-4-(4-chloro-3-methylphenoxy)butan-1-one |
| SMILES | CC(=O)N1CCCN(C(=O)CCCOc2ccc(Cl)c(C)c2)CC1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-14-13-16(6-7-17(14)19)24-12-3-5-18(23)21-9-4-8-20(10-11-21)15(2)22/h6-7,13H,3-5,8-12H2,1-2H3 |
| InChIKey | VUDBPZKWSLCEBP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|