C24H28ClNO4 — CID 134055781
4-(4-chloro-3-methylphenoxy)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]butan-1-one (PubChem CID 134055781) has the molecular formula C24H28ClNO4 and a molecular weight of 429.94 g/mol. Its IUPAC name is 4-(4-chloro-3-methylphenoxy)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(4-chloro-3-methylphenoxy)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 134055781 |
| Molecular Formula | C24H28ClNO4 |
| Molecular Weight | 429.94 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-(4-chloro-3-methylphenoxy)-1-[4-(4-methoxybenzoyl)piperidin-1-yl]butan-1-one |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)CCCOc3ccc(Cl)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H28ClNO4/c1-17-16-21(9-10-22(17)25)30-15-3-4-23(27)26-13-11-19(12-14-26)24(28)18-5-7-20(29-2)8-6-18/h5-10,16,19H,3-4,11-15H2,1-2H3 |
| InChIKey | VAVUMJOGJZLMNR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|