C22H23ClFN3O2 — CID 38619089
2-[4-[4-(4-chloro-3-methylphenoxy)butanoyl]piperazin-1-yl]-6-fluorobenzonitrile (PubChem CID 38619089) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 2-[4-[4-(4-chloro-3-methylphenoxy)butanoyl]piperazin-1-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[4-[4-(4-chloro-3-methylphenoxy)butanoyl]piperazin-1-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 38619089 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[4-[4-(4-chloro-3-methylphenoxy)butanoyl]piperazin-1-yl]-6-fluorobenzonitrile |
| SMILES | Cc1cc(OCCCC(=O)N2CCN(c3cccc(F)c3C#N)CC2)ccc1Cl |
| InChI | InChI=1S/C22H23ClFN3O2/c1-16-14-17(7-8-19(16)23)29-13-3-6-22(28)27-11-9-26(10-12-27)21-5-2-4-20(24)18(21)15-25/h2,4-5,7-8,14H,3,6,9-13H2,1H3 |
| InChIKey | YXQVDRQZMZSVEP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|