C19H24FN3O2 — CID 122150148
2-fluoro-6-[4-[3-(5-methyloxolan-2-yl)propanoyl]piperazin-1-yl]benzonitrile (PubChem CID 122150148) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 2-fluoro-6-[4-[3-(5-methyloxolan-2-yl)propanoyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-fluoro-6-[4-[3-(5-methyloxolan-2-yl)propanoyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 122150148 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-fluoro-6-[4-[3-(5-methyloxolan-2-yl)propanoyl]piperazin-1-yl]benzonitrile |
| SMILES | CC1CCC(CCC(=O)N2CCN(c3cccc(F)c3C#N)CC2)O1 |
| InChI | InChI=1S/C19H24FN3O2/c1-14-5-6-15(25-14)7-8-19(24)23-11-9-22(10-12-23)18-4-2-3-17(20)16(18)13-21/h2-4,14-15H,5-12H2,1H3 |
| InChIKey | LAMWOUBIUMQHNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |