C20H26FN3O — CID 154786225
2-[4-(1-acetylpiperidin-4-yl)azepan-1-yl]-6-fluorobenzonitrile (PubChem CID 154786225) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[4-(1-acetylpiperidin-4-yl)azepan-1-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[4-(1-acetylpiperidin-4-yl)azepan-1-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 154786225 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[4-(1-acetylpiperidin-4-yl)azepan-1-yl]-6-fluorobenzonitrile |
| SMILES | CC(=O)N1CCC(C2CCCN(c3cccc(F)c3C#N)CC2)CC1 |
| InChI | InChI=1S/C20H26FN3O/c1-15(25)23-11-7-17(8-12-23)16-4-3-10-24(13-9-16)20-6-2-5-19(21)18(20)14-22/h2,5-6,16-17H,3-4,7-13H2,1H3 |
| InChIKey | XWTUCOYQDGLEQD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |