C14H16ClN3O — CID 55023991
2-(4-acetyl-1,4-diazepan-1-yl)-6-chlorobenzonitrile (PubChem CID 55023991) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-(4-acetyl-1,4-diazepan-1-yl)-6-chlorobenzonitrile.
| Compound Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-chlorobenzonitrile |
|---|---|
| PubChem CID | 55023991 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-(4-acetyl-1,4-diazepan-1-yl)-6-chlorobenzonitrile |
| SMILES | CC(=O)N1CCCN(c2cccc(Cl)c2C#N)CC1 |
| InChI | InChI=1S/C14H16ClN3O/c1-11(19)17-6-3-7-18(9-8-17)14-5-2-4-13(15)12(14)10-16/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | PMYGTUCTRAWVTE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |