C19H25FN4O — CID 95336773
(2S)-2-[1-(2-cyano-3-fluorophenyl)piperidin-4-yl]azepane-1-carboxamide (PubChem CID 95336773) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is (2S)-2-[1-(2-cyano-3-fluorophenyl)piperidin-4-yl]azepane-1-carboxamide.
| Compound Name | (2S)-2-[1-(2-cyano-3-fluorophenyl)piperidin-4-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 95336773 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (2S)-2-[1-(2-cyano-3-fluorophenyl)piperidin-4-yl]azepane-1-carboxamide |
| SMILES | N#Cc1c(F)cccc1N1CCC([C@@H]2CCCCCN2C(N)=O)CC1 |
| InChI | InChI=1S/C19H25FN4O/c20-16-5-4-7-18(15(16)13-21)23-11-8-14(9-12-23)17-6-2-1-3-10-24(17)19(22)25/h4-5,7,14,17H,1-3,6,8-12H2,(H2,22,25)/t17-/m0/s1 |
| InChIKey | DOCYLRDFCMOHKF-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |