C9H16N2O — CID 140765289
2-cyclopropylpiperidine-1-carboxamide (PubChem CID 140765289) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-cyclopropylpiperidine-1-carboxamide.
| Compound Name | 2-cyclopropylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 140765289 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 2-cyclopropylpiperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCCC1C1CC1 |
| InChI | InChI=1S/C9H16N2O/c10-9(12)11-6-2-1-3-8(11)7-4-5-7/h7-8H,1-6H2,(H2,10,12) |
| InChIKey | ZQKBEHUEMDIVHN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |