C15H18FN3 — CID 139021546
2-[(3aS,7aS)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluorobenzonitrile (PubChem CID 139021546) has the molecular formula C15H18FN3 and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-[(3aS,7aS)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluorobenzonitrile.
| Compound Name | 2-[(3aS,7aS)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 139021546 |
| Molecular Formula | C15H18FN3 |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 2-[(3aS,7aS)-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-fluorobenzonitrile |
| SMILES | CN1CC[C@@H]2CN(c3cccc(F)c3C#N)C[C@@H]2C1 |
| InChI | InChI=1S/C15H18FN3/c1-18-6-5-11-9-19(10-12(11)8-18)15-4-2-3-14(16)13(15)7-17/h2-4,11-12H,5-6,8-10H2,1H3/t11-,12+/m1/s1 |
| InChIKey | STVQSTWHOIUZGU-NEPJUHHUSA-N |
| XLogP | 2.09 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |