C13H16FN3 — CID 47114120
2-fluoro-6-(4-methyl-1,4-diazepan-1-yl)benzonitrile (PubChem CID 47114120) has the molecular formula C13H16FN3 and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-fluoro-6-(4-methyl-1,4-diazepan-1-yl)benzonitrile.
| Compound Name | 2-fluoro-6-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 47114120 |
| Molecular Formula | C13H16FN3 |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-fluoro-6-(4-methyl-1,4-diazepan-1-yl)benzonitrile |
| SMILES | CN1CCCN(c2cccc(F)c2C#N)CC1 |
| InChI | InChI=1S/C13H16FN3/c1-16-6-3-7-17(9-8-16)13-5-2-4-12(14)11(13)10-15/h2,4-5H,3,6-9H2,1H3 |
| InChIKey | AZEIHPGYTWCIMC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |