C14H17FN2 — CID 78957669
2-(3,3-dimethylpiperidin-1-yl)-6-fluorobenzonitrile (PubChem CID 78957669) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 2-(3,3-dimethylpiperidin-1-yl)-6-fluorobenzonitrile.
| Compound Name | 2-(3,3-dimethylpiperidin-1-yl)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 78957669 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2-(3,3-dimethylpiperidin-1-yl)-6-fluorobenzonitrile |
| SMILES | CC1(C)CCCN(c2cccc(F)c2C#N)C1 |
| InChI | InChI=1S/C14H17FN2/c1-14(2)7-4-8-17(10-14)13-6-3-5-12(15)11(13)9-16/h3,5-6H,4,7-8,10H2,1-2H3 |
| InChIKey | NGWLQMZQYAENET-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |