C26H39ClN2O3 — CID 125017401
1-[(3R)-3-[(4-chloro-3-methylphenoxy)methyl]-3-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one (PubChem CID 125017401) has the molecular formula C26H39ClN2O3 and a molecular weight of 463.06 g/mol. Its IUPAC name is 1-[(3R)-3-[(4-chloro-3-methylphenoxy)methyl]-3-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[(3R)-3-[(4-chloro-3-methylphenoxy)methyl]-3-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 125017401 |
| Molecular Formula | C26H39ClN2O3 |
| Molecular Weight | 463.06 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-[(3R)-3-[(4-chloro-3-methylphenoxy)methyl]-3-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC[C@@](COc2ccc(Cl)c(C)c2)(CC(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C26H39ClN2O3/c1-3-4-6-10-24(30)29-16-9-13-26(19-29,18-25(31)28-14-7-5-8-15-28)20-32-22-11-12-23(27)21(2)17-22/h11-12,17H,3-10,13-16,18-20H2,1-2H3/t26-/m1/s1 |
| InChIKey | XHEYTHUSCAWZLF-AREMUKBSSA-N |
| XLogP | 5.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.06 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|