C25H38N2O3 — CID 110081460
1-[3-(2-oxo-2-piperidin-1-ylethyl)-3-(phenoxymethyl)piperidin-1-yl]hexan-1-one (PubChem CID 110081460) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[3-(2-oxo-2-piperidin-1-ylethyl)-3-(phenoxymethyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[3-(2-oxo-2-piperidin-1-ylethyl)-3-(phenoxymethyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 110081460 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1-[3-(2-oxo-2-piperidin-1-ylethyl)-3-(phenoxymethyl)piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCCC(COc2ccccc2)(CC(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C25H38N2O3/c1-2-3-6-14-23(28)27-18-11-15-25(20-27,21-30-22-12-7-4-8-13-22)19-24(29)26-16-9-5-10-17-26/h4,7-8,12-13H,2-3,5-6,9-11,14-21H2,1H3 |
| InChIKey | YYXVJHBCDFAMKT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|