C27H36N2O4S — CID 110081467
2-[1-(4-ethylphenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone (PubChem CID 110081467) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is 2-[1-(4-ethylphenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(4-ethylphenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 110081467 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[1-(4-ethylphenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCC(COc3ccccc3)(CC(=O)N3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C27H36N2O4S/c1-2-23-12-14-25(15-13-23)34(31,32)29-19-9-16-27(21-29,22-33-24-10-5-3-6-11-24)20-26(30)28-17-7-4-8-18-28/h3,5-6,10-15H,2,4,7-9,16-22H2,1H3 |
| InChIKey | SHBQEQPNBUCROV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |