C20H23FN2O4S — CID 124977428
2-[(3S)-1-(4-fluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide (PubChem CID 124977428) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[(3S)-1-(4-fluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-1-(4-fluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 124977428 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[(3S)-1-(4-fluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@]1(COc2ccccc2)CCCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H23FN2O4S/c21-16-7-9-18(10-8-16)28(25,26)23-12-4-11-20(14-23,13-19(22)24)15-27-17-5-2-1-3-6-17/h1-3,5-10H,4,11-15H2,(H2,22,24)/t20-/m0/s1 |
| InChIKey | LMCZLISVNNQQKQ-FQEVSTJZSA-N |
| XLogP | 2.55 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |