C20H22F2N2O4S — CID 110081253
2-[1-(2,6-difluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide (PubChem CID 110081253) has the molecular formula C20H22F2N2O4S and a molecular weight of 424.47 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide.
| Compound Name | 2-[1-(2,6-difluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 110081253 |
| Molecular Formula | C20H22F2N2O4S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)sulfonyl-3-(phenoxymethyl)piperidin-3-yl]acetamide |
| SMILES | NC(=O)CC1(COc2ccccc2)CCCN(S(=O)(=O)c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C20H22F2N2O4S/c21-16-8-4-9-17(22)19(16)29(26,27)24-11-5-10-20(13-24,12-18(23)25)14-28-15-6-2-1-3-7-15/h1-4,6-9H,5,10-14H2,(H2,23,25) |
| InChIKey | UVHMYDLDMMJFEK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |