C20H22ClFN2O4S — CID 124971945
2-[(3S)-3-[(3-chlorophenoxy)methyl]-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]acetamide (PubChem CID 124971945) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is 2-[(3S)-3-[(3-chlorophenoxy)methyl]-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]acetamide.
| Compound Name | 2-[(3S)-3-[(3-chlorophenoxy)methyl]-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 124971945 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[(3S)-3-[(3-chlorophenoxy)methyl]-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]acetamide |
| SMILES | NC(=O)C[C@@]1(COc2cccc(Cl)c2)CCCN(S(=O)(=O)c2ccccc2F)C1 |
| InChI | InChI=1S/C20H22ClFN2O4S/c21-15-5-3-6-16(11-15)28-14-20(12-19(23)25)9-4-10-24(13-20)29(26,27)18-8-2-1-7-17(18)22/h1-3,5-8,11H,4,9-10,12-14H2,(H2,23,25)/t20-/m0/s1 |
| InChIKey | JZSPQXVAEZSXHC-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |