C26H34N2O4S — CID 125016615
2-[(3R)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone (PubChem CID 125016615) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is 2-[(3R)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(3R)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 125016615 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-[(3R)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(C[C@]1(COc2ccccc2)CCCN(S(=O)(=O)Cc2ccccc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C26H34N2O4S/c29-25(27-16-8-3-9-17-27)19-26(22-32-24-13-6-2-7-14-24)15-10-18-28(21-26)33(30,31)20-23-11-4-1-5-12-23/h1-2,4-7,11-14H,3,8-10,15-22H2/t26-/m1/s1 |
| InChIKey | XBQHLJQFXFWMLW-AREMUKBSSA-N |
| XLogP | 4.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |