C29H34N2O4S — CID 124983540
N-benzyl-2-[(3S)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide (PubChem CID 124983540) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-benzyl-2-[(3S)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[(3S)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 124983540 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-benzyl-2-[(3S)-1-benzylsulfonyl-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)C[C@@]1(COc2ccccc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C29H34N2O4S/c1-30(21-25-12-5-2-6-13-25)28(32)20-29(24-35-27-16-9-4-10-17-27)18-11-19-31(23-29)36(33,34)22-26-14-7-3-8-15-26/h2-10,12-17H,11,18-24H2,1H3/t29-/m0/s1 |
| InChIKey | NENKSAVWOXRBQZ-LJAQVGFWSA-N |
| XLogP | 4.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |