C29H32N2O3 — CID 110081175
2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-N-benzyl-N-methylacetamide (PubChem CID 110081175) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-N-benzyl-N-methylacetamide.
| Compound Name | 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-N-benzyl-N-methylacetamide |
|---|---|
| PubChem CID | 110081175 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-N-benzyl-N-methylacetamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC1(COc2ccccc2)CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H32N2O3/c1-30(21-24-12-5-2-6-13-24)27(32)20-29(23-34-26-16-9-4-10-17-26)18-11-19-31(22-29)28(33)25-14-7-3-8-15-25/h2-10,12-17H,11,18-23H2,1H3 |
| InChIKey | GCHFJCHDRBEOHK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |