C30H34N2O4 — CID 110081174
N-benzyl-2-[1-(3-methoxybenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide (PubChem CID 110081174) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is N-benzyl-2-[1-(3-methoxybenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide.
| Compound Name | N-benzyl-2-[1-(3-methoxybenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 110081174 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N-benzyl-2-[1-(3-methoxybenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-N-methylacetamide |
| SMILES | COc1cccc(C(=O)N2CCCC(COc3ccccc3)(CC(=O)N(C)Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C30H34N2O4/c1-31(21-24-11-5-3-6-12-24)28(33)20-30(23-36-26-14-7-4-8-15-26)17-10-18-32(22-30)29(34)25-13-9-16-27(19-25)35-2/h3-9,11-16,19H,10,17-18,20-23H2,1-2H3 |
| InChIKey | DZRMIODCHZGQFT-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |