C26H31ClN2O3 — CID 125013729
2-[(3R)-1-(4-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone (PubChem CID 125013729) has the molecular formula C26H31ClN2O3 and a molecular weight of 455.00 g/mol. Its IUPAC name is 2-[(3R)-1-(4-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(3R)-1-(4-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 125013729 |
| Molecular Formula | C26H31ClN2O3 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[(3R)-1-(4-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(C[C@]1(COc2ccccc2)CCCN(C(=O)c2ccc(Cl)cc2)C1)N1CCCCC1 |
| InChI | InChI=1S/C26H31ClN2O3/c27-22-12-10-21(11-13-22)25(31)29-17-7-14-26(19-29,20-32-23-8-3-1-4-9-23)18-24(30)28-15-5-2-6-16-28/h1,3-4,8-13H,2,5-7,14-20H2/t26-/m1/s1 |
| InChIKey | WHCMGXRMYPLMON-AREMUKBSSA-N |
| XLogP | 5.04 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |