C29H38N2O4 — CID 124982974
2-[(3R)-1-(4-tert-butylbenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone (PubChem CID 124982974) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[(3R)-1-(4-tert-butylbenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3R)-1-(4-tert-butylbenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 124982974 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 2-[(3R)-1-(4-tert-butylbenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCC[C@@](COc3ccccc3)(CC(=O)N3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C29H38N2O4/c1-28(2,3)24-12-10-23(11-13-24)27(33)31-15-7-14-29(21-31,22-35-25-8-5-4-6-9-25)20-26(32)30-16-18-34-19-17-30/h4-6,8-13H,7,14-22H2,1-3H3/t29-/m1/s1 |
| InChIKey | NAUGVYHJQDEHPC-GDLZYMKVSA-N |
| XLogP | 4.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |