C25H29ClN2O4 — CID 110081704
2-[1-(3-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone (PubChem CID 110081704) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is 2-[1-(3-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-(3-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 110081704 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[1-(3-chlorobenzoyl)-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CC1(COc2ccccc2)CCCN(C(=O)c2cccc(Cl)c2)C1)N1CCOCC1 |
| InChI | InChI=1S/C25H29ClN2O4/c26-21-7-4-6-20(16-21)24(30)28-11-5-10-25(18-28,19-32-22-8-2-1-3-9-22)17-23(29)27-12-14-31-15-13-27/h1-4,6-9,16H,5,10-15,17-19H2 |
| InChIKey | YFEXANUMPZVBGF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |