C25H30N2O4 — CID 155990434
2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone (PubChem CID 155990434) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 155990434 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[1-benzoyl-3-(phenoxymethyl)piperidin-3-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CC1(COc2ccccc2)CCCN(C(=O)c2ccccc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C25H30N2O4/c28-23(26-14-16-30-17-15-26)18-25(20-31-22-10-5-2-6-11-22)12-7-13-27(19-25)24(29)21-8-3-1-4-9-21/h1-6,8-11H,7,12-20H2 |
| InChIKey | SQMRPYCEROKEGB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |