C25H37FN2O3 — CID 110081062
1-[4-[(4-fluorophenoxy)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one (PubChem CID 110081062) has the molecular formula C25H37FN2O3 and a molecular weight of 432.58 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenoxy)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[(4-fluorophenoxy)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 110081062 |
| Molecular Formula | C25H37FN2O3 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | 1-[4-[(4-fluorophenoxy)methyl]-4-(2-oxo-2-piperidin-1-ylethyl)piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(COc2ccc(F)cc2)(CC(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C25H37FN2O3/c1-2-3-5-8-23(29)28-17-13-25(14-18-28,19-24(30)27-15-6-4-7-16-27)20-31-22-11-9-21(26)10-12-22/h9-12H,2-8,13-20H2,1H3 |
| InChIKey | FVUMZNXMJNQYMJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|