C23H24ClN3O3 — CID 46431367
methyl 2-(4-chlorophenyl)-2-[4-[3-(4-cyanophenyl)propanoyl]piperazin-1-yl]acetate (PubChem CID 46431367) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is methyl 2-(4-chlorophenyl)-2-[4-[3-(4-cyanophenyl)propanoyl]piperazin-1-yl]acetate.
| Compound Name | methyl 2-(4-chlorophenyl)-2-[4-[3-(4-cyanophenyl)propanoyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 46431367 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | methyl 2-(4-chlorophenyl)-2-[4-[3-(4-cyanophenyl)propanoyl]piperazin-1-yl]acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)CCc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-30-23(29)22(19-7-9-20(24)10-8-19)27-14-12-26(13-15-27)21(28)11-6-17-2-4-18(16-25)5-3-17/h2-5,7-10,22H,6,11-15H2,1H3 |
| InChIKey | ZPEXPDLLQBVOOM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |