C22H29ClN4O2S — CID 108753480
4-(4-chlorophenoxy)-1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 108753480) has the molecular formula C22H29ClN4O2S and a molecular weight of 449.02 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenoxy)-1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108753480 |
| Molecular Formula | C22H29ClN4O2S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-(4-chlorophenoxy)-1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1)N1CCN(c2nnc(C3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C22H29ClN4O2S/c23-18-8-10-19(11-9-18)29-16-4-7-20(28)26-12-14-27(15-13-26)22-25-24-21(30-22)17-5-2-1-3-6-17/h8-11,17H,1-7,12-16H2 |
| InChIKey | GQKGPXKZXNVCBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|