C26H32N4O2S — CID 108753475
1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one (PubChem CID 108753475) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one.
| Compound Name | 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one |
|---|---|
| PubChem CID | 108753475 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-4-naphthalen-2-yloxybutan-1-one |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)N1CCN(c2nnc(C3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C26H32N4O2S/c31-24(11-6-18-32-23-13-12-20-7-4-5-10-22(20)19-23)29-14-16-30(17-15-29)26-28-27-25(33-26)21-8-2-1-3-9-21/h4-5,7,10,12-13,19,21H,1-3,6,8-9,11,14-18H2 |
| InChIKey | BVSAYFXWUAIRFC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|