C21H26N4O3S — CID 108729633
[4-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108729633) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is [4-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [4-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108729633 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [4-[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)N2CCN(c3nnc(C4CCCCC4)s3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-15(26)28-18-9-7-17(8-10-18)20(27)24-11-13-25(14-12-24)21-23-22-19(29-21)16-5-3-2-4-6-16/h7-10,16H,2-6,11-14H2,1H3 |
| InChIKey | WYTNGNTUWOZJPU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|