C23H30N6O4S — CID 108729655
[4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 108729655) has the molecular formula C23H30N6O4S and a molecular weight of 486.60 g/mol. Its IUPAC name is [4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 108729655 |
| Molecular Formula | C23H30N6O4S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | [4-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N1CCN(c2nnc(C3CCCCC3)s2)CC1 |
| InChI | InChI=1S/C23H30N6O4S/c30-22(18-6-7-19(20(16-18)29(31)32)26-12-14-33-15-13-26)27-8-10-28(11-9-27)23-25-24-21(34-23)17-4-2-1-3-5-17/h6-7,16-17H,1-5,8-15H2 |
| InChIKey | FMZJRVFXBOBXMA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|