C25H27N3O7 — CID 16606399
2,3-dihydro-1,4-benzodioxin-6-yl-[1-(4-morpholin-4-yl-3-nitrobenzoyl)piperidin-4-yl]methanone (PubChem CID 16606399) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[1-(4-morpholin-4-yl-3-nitrobenzoyl)piperidin-4-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-(4-morpholin-4-yl-3-nitrobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 16606399 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-(4-morpholin-4-yl-3-nitrobenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)OCCO2)C1CCN(C(=O)c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C25H27N3O7/c29-24(18-2-4-22-23(16-18)35-14-13-34-22)17-5-7-27(8-6-17)25(30)19-1-3-20(21(15-19)28(31)32)26-9-11-33-12-10-26/h1-4,15-17H,5-14H2 |
| InChIKey | HCNWDJPWICEHBP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|