C27H31N3O6 — CID 25482351
2,3-dihydro-1,4-benzodioxin-6-yl-[1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidin-4-yl]methanone (PubChem CID 25482351) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidin-4-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 25482351 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidin-4-yl]methanone |
| SMILES | CC1CCN(c2ccc(C(=O)N3CCC(C(=O)c4ccc5c(c4)OCCO5)CC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H31N3O6/c1-18-6-10-28(11-7-18)22-4-2-21(16-23(22)30(33)34)27(32)29-12-8-19(9-13-29)26(31)20-3-5-24-25(17-20)36-15-14-35-24/h2-5,16-19H,6-15H2,1H3 |
| InChIKey | HHBHIFFBEVPTFA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|