C24H26N4O6 — CID 26456696
N-(1,3-benzodioxol-5-yl)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide (PubChem CID 26456696) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26456696 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(3-nitro-4-pyrrolidin-1-ylbenzoyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C24H26N4O6/c29-23(25-18-4-6-21-22(14-18)34-15-33-21)16-7-11-27(12-8-16)24(30)17-3-5-19(20(13-17)28(31)32)26-9-1-2-10-26/h3-6,13-14,16H,1-2,7-12,15H2,(H,25,29) |
| InChIKey | KMEGTKXDLSBYCF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|