C23H20ClN3O4 — CID 55731130
N-(1,3-benzodioxol-5-yl)-1-(2-chloroquinoline-6-carbonyl)piperidine-4-carboxamide (PubChem CID 55731130) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(2-chloroquinoline-6-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloroquinoline-6-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55731130 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloroquinoline-6-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(C(=O)c2ccc3nc(Cl)ccc3c2)CC1 |
| InChI | InChI=1S/C23H20ClN3O4/c24-21-6-2-15-11-16(1-4-18(15)26-21)23(29)27-9-7-14(8-10-27)22(28)25-17-3-5-19-20(12-17)31-13-30-19/h1-6,11-12,14H,7-10,13H2,(H,25,28) |
| InChIKey | XIMUVGXTJYSMOX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|