C22H22N2O4 — CID 166433775
N-(1,3-benzodioxol-5-yl)-1-(cubane-1-carbonyl)piperidine-4-carboxamide (PubChem CID 166433775) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(cubane-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(cubane-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 166433775 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(cubane-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(C(=O)C23C4C5C6C4C2C6C53)CC1 |
| InChI | InChI=1S/C22H22N2O4/c25-20(23-10-1-2-11-12(7-10)28-8-27-11)9-3-5-24(6-4-9)21(26)22-17-14-13-15(17)19(22)16(13)18(14)22/h1-2,7,9,13-19H,3-6,8H2,(H,23,25) |
| InChIKey | OSASFRKPKJPQTH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |