C21H17F5N2O4 — CID 16575048
N-(1,3-benzodioxol-5-yl)-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]piperidine-4-carboxamide (PubChem CID 16575048) has the molecular formula C21H17F5N2O4 and a molecular weight of 456.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16575048 |
| Molecular Formula | C21H17F5N2O4 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[2-(2,3,4,5,6-pentafluorophenyl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(C(=O)Cc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H17F5N2O4/c22-16-12(17(23)19(25)20(26)18(16)24)8-15(29)28-5-3-10(4-6-28)21(30)27-11-1-2-13-14(7-11)32-9-31-13/h1-2,7,10H,3-6,8-9H2,(H,27,30) |
| InChIKey | NERVPOYEOOYCNK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|