C24H22N2O6 — CID 46926488
1-(1,3-benzodioxole-5-carbonyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-4-carboxamide (PubChem CID 46926488) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46926488 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(4-methyl-2-oxochromen-7-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C3CCN(C(=O)c4ccc5c(c4)OCO5)CC3)ccc12 |
| InChI | InChI=1S/C24H22N2O6/c1-14-10-22(27)32-20-12-17(3-4-18(14)20)25-23(28)15-6-8-26(9-7-15)24(29)16-2-5-19-21(11-16)31-13-30-19/h2-5,10-12,15H,6-9,13H2,1H3,(H,25,28) |
| InChIKey | MMHXRCAXVLMFQH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|