C22H24N4O6 — CID 31715013
N-(1,3-benzodioxol-5-yl)-1-[2-(dimethylamino)-5-nitrobenzoyl]piperidine-4-carboxamide (PubChem CID 31715013) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-[2-(dimethylamino)-5-nitrobenzoyl]piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-[2-(dimethylamino)-5-nitrobenzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31715013 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-[2-(dimethylamino)-5-nitrobenzoyl]piperidine-4-carboxamide |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1C(=O)N1CCC(C(=O)Nc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H24N4O6/c1-24(2)18-5-4-16(26(29)30)12-17(18)22(28)25-9-7-14(8-10-25)21(27)23-15-3-6-19-20(11-15)32-13-31-19/h3-6,11-12,14H,7-10,13H2,1-2H3,(H,23,27) |
| InChIKey | NXASWQZEVQXHQO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|