C19H18ClN3O7S — CID 3523433
N-(1,3-benzodioxol-5-yl)-1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 3523433) has the molecular formula C19H18ClN3O7S and a molecular weight of 467.89 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3523433 |
| Molecular Formula | C19H18ClN3O7S |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(2-chloro-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2Cl)CC1 |
| InChI | InChI=1S/C19H18ClN3O7S/c20-15-3-2-14(23(25)26)10-18(15)31(27,28)22-7-5-12(6-8-22)19(24)21-13-1-4-16-17(9-13)30-11-29-16/h1-4,9-10,12H,5-8,11H2,(H,21,24) |
| InChIKey | FTDYXMKNZHOKRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|