C23H25F2N3O4 — CID 133480607
[4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 133480607) has the molecular formula C23H25F2N3O4 and a molecular weight of 445.47 g/mol. Its IUPAC name is [4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-3-nitrophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-3-nitrophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133480607 |
| Molecular Formula | C23H25F2N3O4 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [4-[4-[(3,4-difluorophenyl)methyl]piperidin-1-yl]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(N2CCC(Cc3ccc(F)c(F)c3)CC2)c([N+](=O)[O-])c1)N1CCOCC1 |
| InChI | InChI=1S/C23H25F2N3O4/c24-19-3-1-17(14-20(19)25)13-16-5-7-26(8-6-16)21-4-2-18(15-22(21)28(30)31)23(29)27-9-11-32-12-10-27/h1-4,14-16H,5-13H2 |
| InChIKey | GICNKDDKELYWBU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|