C21H28N6O4 — CID 133448975
morpholin-4-yl-[3-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]phenyl]methanone (PubChem CID 133448975) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is morpholin-4-yl-[3-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[3-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 133448975 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | morpholin-4-yl-[3-nitro-4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]phenyl]methanone |
| SMILES | CC(C)n1cnnc1C1CCCN(c2ccc(C(=O)N3CCOCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H28N6O4/c1-15(2)26-14-22-23-20(26)17-4-3-7-25(13-17)18-6-5-16(12-19(18)27(29)30)21(28)24-8-10-31-11-9-24/h5-6,12,14-15,17H,3-4,7-11,13H2,1-2H3 |
| InChIKey | WAENODQJMYNFII-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|