C20H28N4O5 — CID 16962507
N-methyl-4-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-yl-2-oxoethyl)-3-nitrobenzamide (PubChem CID 16962507) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-methyl-4-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-yl-2-oxoethyl)-3-nitrobenzamide.
| Compound Name | N-methyl-4-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-yl-2-oxoethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 16962507 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-methyl-4-(3-methylpiperidin-1-yl)-N-(2-morpholin-4-yl-2-oxoethyl)-3-nitrobenzamide |
| SMILES | CC1CCCN(c2ccc(C(=O)N(C)CC(=O)N3CCOCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H28N4O5/c1-15-4-3-7-23(13-15)17-6-5-16(12-18(17)24(27)28)20(26)21(2)14-19(25)22-8-10-29-11-9-22/h5-6,12,15H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | JGYDHAFRMRZSBR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|