C14H16N6O4 — CID 43063352
1-(2,4-dinitrophenyl)-3-(4-methyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 43063352) has the molecular formula C14H16N6O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-3-(4-methyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 1-(2,4-dinitrophenyl)-3-(4-methyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 43063352 |
| Molecular Formula | C14H16N6O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-3-(4-methyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | Cn1cnnc1C1CCCN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H16N6O4/c1-17-9-15-16-14(17)10-3-2-6-18(8-10)12-5-4-11(19(21)22)7-13(12)20(23)24/h4-5,7,9-10H,2-3,6,8H2,1H3 |
| InChIKey | WQEKCFINNSQTEZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 120.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|