C15H18FN5O3 — CID 138009062
[5-[1-(2-fluoro-4-nitrophenyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methanol (PubChem CID 138009062) has the molecular formula C15H18FN5O3 and a molecular weight of 335.34 g/mol. Its IUPAC name is [5-[1-(2-fluoro-4-nitrophenyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[1-(2-fluoro-4-nitrophenyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 138009062 |
| Molecular Formula | C15H18FN5O3 |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [5-[1-(2-fluoro-4-nitrophenyl)piperidin-3-yl]-4-methyl-1,2,4-triazol-3-yl]methanol |
| SMILES | Cn1c(CO)nnc1C1CCCN(c2ccc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C15H18FN5O3/c1-19-14(9-22)17-18-15(19)10-3-2-6-20(8-10)13-5-4-11(21(23)24)7-12(13)16/h4-5,7,10,22H,2-3,6,8-9H2,1H3 |
| InChIKey | LYWAVLPJHKLCFV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|